C14H18O5S — CID 6669613
(2R,4R)-2-(4-hydroxybutoxy)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 6669613) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is (2R,4R)-2-(4-hydroxybutoxy)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,4R)-2-(4-hydroxybutoxy)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 6669613 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (2R,4R)-2-(4-hydroxybutoxy)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | O=C(O)C1=C[C@H](c2ccsc2)C[C@H](OCCCCO)O1 |
| InChI | InChI=1S/C14H18O5S/c15-4-1-2-5-18-13-8-11(10-3-6-20-9-10)7-12(19-13)14(16)17/h3,6-7,9,11,13,15H,1-2,4-5,8H2,(H,16,17)/t11-,13+/m0/s1 |
| InChIKey | JGBHYORVICJZNL-WCQYABFASA-N |
| XLogP | 2.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|