C19H27NO5S — CID 6672230
[(2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-yl]-piperidin-1-ylmethanone (PubChem CID 6672230) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is [(2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-yl]-piperidin-1-ylmethanone.
| Compound Name | [(2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 6672230 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [(2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(C1=C[C@H](c2ccsc2)C[C@H](OCCOCCO)O1)N1CCCCC1 |
| InChI | InChI=1S/C19H27NO5S/c21-7-8-23-9-10-24-18-13-16(15-4-11-26-14-15)12-17(25-18)19(22)20-5-2-1-3-6-20/h4,11-12,14,16,18,21H,1-3,5-10,13H2/t16-,18+/m0/s1 |
| InChIKey | OQKPOPOLCFVCPO-FUHWJXTLSA-N |
| XLogP | 2.50 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|