C14H19NO4S — CID 23975630
(2R,4R)-2-(4-hydroxybutoxy)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23975630) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is (2R,4R)-2-(4-hydroxybutoxy)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-2-(4-hydroxybutoxy)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23975630 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2R,4R)-2-(4-hydroxybutoxy)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | NC(=O)C1=C[C@H](c2ccsc2)C[C@H](OCCCCO)O1 |
| InChI | InChI=1S/C14H19NO4S/c15-14(17)12-7-11(10-3-6-20-9-10)8-13(19-12)18-5-2-1-4-16/h3,6-7,9,11,13,16H,1-2,4-5,8H2,(H2,15,17)/t11-,13+/m0/s1 |
| InChIKey | RHIFBAHOEUUQCX-WCQYABFASA-N |
| XLogP | 1.74 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|