C18H23N3O4S — CID 6672171
(2R,4R)-2-(3-hydroxypropoxy)-N-[2-(1H-imidazol-5-yl)ethyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6672171) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is (2R,4R)-2-(3-hydroxypropoxy)-N-[2-(1H-imidazol-5-yl)ethyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-2-(3-hydroxypropoxy)-N-[2-(1H-imidazol-5-yl)ethyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6672171 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (2R,4R)-2-(3-hydroxypropoxy)-N-[2-(1H-imidazol-5-yl)ethyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCCc1cnc[nH]1)C1=C[C@H](c2ccsc2)C[C@H](OCCCO)O1 |
| InChI | InChI=1S/C18H23N3O4S/c22-5-1-6-24-17-9-14(13-3-7-26-11-13)8-16(25-17)18(23)20-4-2-15-10-19-12-21-15/h3,7-8,10-12,14,17,22H,1-2,4-6,9H2,(H,19,21)(H,20,23)/t14-,17+/m0/s1 |
| InChIKey | FRCXKJJVJVTBAX-WMLDXEAASA-N |
| XLogP | 1.94 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|