C22H31NO9 — CID 3325431
4-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 3325431) has the molecular formula C22H31NO9 and a molecular weight of 453.49 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 3325431 |
| Molecular Formula | C22H31NO9 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | COC(CN(C)C(=O)C1=CC(c2ccc3c(c2)OCO3)CC(OCCOCCO)O1)OC |
| InChI | InChI=1S/C22H31NO9/c1-23(13-21(26-2)27-3)22(25)19-11-16(12-20(32-19)29-9-8-28-7-6-24)15-4-5-17-18(10-15)31-14-30-17/h4-5,10-11,16,20-21,24H,6-9,12-14H2,1-3H3 |
| InChIKey | PTXPZEGIWOZRJG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|