C26H39NO10 — CID 6671914
(2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6671914) has the molecular formula C26H39NO10 and a molecular weight of 525.60 g/mol. Its IUPAC name is (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6671914 |
| Molecular Formula | C26H39NO10 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)N(C)CC(OC)OC)=C[C@H](c2ccc3c(c2)OCO3)[C@@H]1CCOCCOCCO |
| InChI | InChI=1S/C26H39NO10/c1-5-34-26-19(8-10-32-12-13-33-11-9-28)20(18-6-7-21-22(14-18)36-17-35-21)15-23(37-26)25(29)27(2)16-24(30-3)31-4/h6-7,14-15,19-20,24,26,28H,5,8-13,16-17H2,1-4H3/t19-,20+,26+/m0/s1 |
| InChIKey | RXBSOMBUNOKOJU-OUDXUNEISA-N |
| XLogP | 1.88 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|