C28H39NO8 — CID 6670961
(2S,3R,4R)-4-(1,3-benzodioxol-5-yl)-N-(2-bicyclo[2.2.1]heptanyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6670961) has the molecular formula C28H39NO8 and a molecular weight of 517.62 g/mol. Its IUPAC name is (2S,3R,4R)-4-(1,3-benzodioxol-5-yl)-N-(2-bicyclo[2.2.1]heptanyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-4-(1,3-benzodioxol-5-yl)-N-(2-bicyclo[2.2.1]heptanyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6670961 |
| Molecular Formula | C28H39NO8 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | (2S,3R,4R)-4-(1,3-benzodioxol-5-yl)-N-(2-bicyclo[2.2.1]heptanyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)NC2CC3CCC2C3)=C[C@@H](c2ccc3c(c2)OCO3)[C@H]1CCOCCOCCO |
| InChI | InChI=1S/C28H39NO8/c1-2-34-28-21(7-9-32-11-12-33-10-8-30)22(19-5-6-24-25(15-19)36-17-35-24)16-26(37-28)27(31)29-23-14-18-3-4-20(23)13-18/h5-6,15-16,18,20-23,28,30H,2-4,7-14,17H2,1H3,(H,29,31)/t18?,20?,21-,22+,23?,28+/m1/s1 |
| InChIKey | IRUPONUZHHYHCS-HUNPNPMDSA-N |
| XLogP | 3.11 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|