C28H36N4O10 — CID 4251225
4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 4251225) has the molecular formula C28H36N4O10 and a molecular weight of 588.61 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 4251225 |
| Molecular Formula | C28H36N4O10 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCOC1OC(C(=O)NCCNc2ccc([N+](=O)[O-])cn2)=CC(c2ccc3c(c2)OCO3)C1CCOCCOCCO |
| InChI | InChI=1S/C28H36N4O10/c1-2-39-28-21(7-11-37-13-14-38-12-10-33)22(19-3-5-23-24(15-19)41-18-40-23)16-25(42-28)27(34)30-9-8-29-26-6-4-20(17-31-26)32(35)36/h3-6,15-17,21-22,28,33H,2,7-14,18H2,1H3,(H,29,31)(H,30,34) |
| InChIKey | HPCDENUNTOXCTI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 172.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|