C25H32N4O7 — CID 23902845
(2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-4-(4-methoxyphenyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23902845) has the molecular formula C25H32N4O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is (2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-4-(4-methoxyphenyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-4-(4-methoxyphenyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23902845 |
| Molecular Formula | C25H32N4O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-4-(4-methoxyphenyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)NCCNc2ccc([N+](=O)[O-])cn2)=C[C@H](c2ccc(OC)cc2)[C@H]1CCCO |
| InChI | InChI=1S/C25H32N4O7/c1-3-35-25-20(5-4-14-30)21(17-6-9-19(34-2)10-7-17)15-22(36-25)24(31)27-13-12-26-23-11-8-18(16-28-23)29(32)33/h6-11,15-16,20-21,25,30H,3-5,12-14H2,1-2H3,(H,26,28)(H,27,31)/t20-,21-,25-/m1/s1 |
| InChIKey | VDFCJKUJHQWMIR-DNRQZRRGSA-N |
| XLogP | 2.98 |
| TPSA | 145.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|