C29H38N4O10 — CID 6671586
methyl 4-[(2S,3S,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate (PubChem CID 6671586) has the molecular formula C29H38N4O10 and a molecular weight of 602.64 g/mol. Its IUPAC name is methyl 4-[(2S,3S,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate.
| Compound Name | methyl 4-[(2S,3S,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate |
|---|---|
| PubChem CID | 6671586 |
| Molecular Formula | C29H38N4O10 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | methyl 4-[(2S,3S,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate |
| SMILES | CCO[C@H]1OC(C(=O)NCCNc2ccc([N+](=O)[O-])cn2)=C[C@@H](c2ccc(C(=O)OC)cc2)[C@@H]1CCOCCOCCO |
| InChI | InChI=1S/C29H38N4O10/c1-3-42-29-23(10-14-40-16-17-41-15-13-34)24(20-4-6-21(7-5-20)28(36)39-2)18-25(43-29)27(35)31-12-11-30-26-9-8-22(19-32-26)33(37)38/h4-9,18-19,23-24,29,34H,3,10-17H2,1-2H3,(H,30,32)(H,31,35)/t23-,24-,29-/m0/s1 |
| InChIKey | HRNZUQYUGUQWCH-MOMDTQCHSA-N |
| XLogP | 2.40 |
| TPSA | 180.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|