C26H32N4O8 — CID 6669300
methyl 4-[(2S,3S,4R)-2-ethoxy-3-(3-hydroxypropyl)-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate (PubChem CID 6669300) has the molecular formula C26H32N4O8 and a molecular weight of 528.56 g/mol. Its IUPAC name is methyl 4-[(2S,3S,4R)-2-ethoxy-3-(3-hydroxypropyl)-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate.
| Compound Name | methyl 4-[(2S,3S,4R)-2-ethoxy-3-(3-hydroxypropyl)-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate |
|---|---|
| PubChem CID | 6669300 |
| Molecular Formula | C26H32N4O8 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | methyl 4-[(2S,3S,4R)-2-ethoxy-3-(3-hydroxypropyl)-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate |
| SMILES | CCO[C@H]1OC(C(=O)NCCNc2ccc([N+](=O)[O-])cn2)=C[C@@H](c2ccc(C(=O)OC)cc2)[C@@H]1CCCO |
| InChI | InChI=1S/C26H32N4O8/c1-3-37-26-20(5-4-14-31)21(17-6-8-18(9-7-17)25(33)36-2)15-22(38-26)24(32)28-13-12-27-23-11-10-19(16-29-23)30(34)35/h6-11,15-16,20-21,26,31H,3-5,12-14H2,1-2H3,(H,27,29)(H,28,32)/t20-,21-,26-/m0/s1 |
| InChIKey | VMACOCAURORYMH-WOVHNISZSA-N |
| XLogP | 2.75 |
| TPSA | 162.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|