C20H28N4O6 — CID 23846998
(2S,4R)-4-cyclopropyl-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23846998) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is (2S,4R)-4-cyclopropyl-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4R)-4-cyclopropyl-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23846998 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (2S,4R)-4-cyclopropyl-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCCNc1ccc([N+](=O)[O-])cn1)C1=C[C@@H](C2CC2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C20H28N4O6/c25-9-1-2-10-29-19-12-15(14-3-4-14)11-17(30-19)20(26)22-8-7-21-18-6-5-16(13-23-18)24(27)28/h5-6,11,13-15,19,25H,1-4,7-10,12H2,(H,21,23)(H,22,26)/t15-,19+/m1/s1 |
| InChIKey | AHQGFVCYNXBLET-BEFAXECRSA-N |
| XLogP | 1.96 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|