C17H27NO4 — CID 23902811
(2S,4R)-4-cyclopropyl-N-(cyclopropylmethyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23902811) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2S,4R)-4-cyclopropyl-N-(cyclopropylmethyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4R)-4-cyclopropyl-N-(cyclopropylmethyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23902811 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (2S,4R)-4-cyclopropyl-N-(cyclopropylmethyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCC1CC1)C1=C[C@@H](C2CC2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C17H27NO4/c19-7-1-2-8-21-16-10-14(13-5-6-13)9-15(22-16)17(20)18-11-12-3-4-12/h9,12-14,16,19H,1-8,10-11H2,(H,18,20)/t14-,16+/m1/s1 |
| InChIKey | ZKVSNRAIFMINGB-ZBFHGGJFSA-N |
| XLogP | 1.96 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|