C20H28N2O4 — CID 23760575
(2S,4R)-4-cyclopentyl-2-(4-hydroxybutoxy)-N-pyridin-3-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23760575) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is (2S,4R)-4-cyclopentyl-2-(4-hydroxybutoxy)-N-pyridin-3-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4R)-4-cyclopentyl-2-(4-hydroxybutoxy)-N-pyridin-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23760575 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (2S,4R)-4-cyclopentyl-2-(4-hydroxybutoxy)-N-pyridin-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1=C[C@@H](C2CCCC2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C20H28N2O4/c23-10-3-4-11-25-19-13-16(15-6-1-2-7-15)12-18(26-19)20(24)22-17-8-5-9-21-14-17/h5,8-9,12,14-16,19,23H,1-4,6-7,10-11,13H2,(H,22,24)/t16-,19+/m1/s1 |
| InChIKey | BDJPTDCMEHVFDX-APWZRJJASA-N |
| XLogP | 3.25 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|