C18H31NO5 — CID 23847009
(2S,4R)-4-cyclopentyl-2-(4-hydroxybutoxy)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23847009) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is (2S,4R)-4-cyclopentyl-2-(4-hydroxybutoxy)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4R)-4-cyclopentyl-2-(4-hydroxybutoxy)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23847009 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (2S,4R)-4-cyclopentyl-2-(4-hydroxybutoxy)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | COCCNC(=O)C1=C[C@@H](C2CCCC2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C18H31NO5/c1-22-11-8-19-18(21)16-12-15(14-6-2-3-7-14)13-17(24-16)23-10-5-4-9-20/h12,14-15,17,20H,2-11,13H2,1H3,(H,19,21)/t15-,17+/m1/s1 |
| InChIKey | IRUOBCJBGVWLSX-WBVHZDCISA-N |
| XLogP | 1.97 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|