C25H34N2O7 — CID 6670193
methyl 4-[(2S,4S)-2-(4-hydroxybutoxy)-6-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate (PubChem CID 6670193) has the molecular formula C25H34N2O7 and a molecular weight of 474.55 g/mol. Its IUPAC name is methyl 4-[(2S,4S)-2-(4-hydroxybutoxy)-6-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate.
| Compound Name | methyl 4-[(2S,4S)-2-(4-hydroxybutoxy)-6-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate |
|---|---|
| PubChem CID | 6670193 |
| Molecular Formula | C25H34N2O7 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | methyl 4-[(2S,4S)-2-(4-hydroxybutoxy)-6-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C=C(C(=O)NCCCN3CCCC3=O)O[C@H](OCCCCO)C2)cc1 |
| InChI | InChI=1S/C25H34N2O7/c1-32-25(31)19-9-7-18(8-10-19)20-16-21(34-23(17-20)33-15-3-2-14-28)24(30)26-11-5-13-27-12-4-6-22(27)29/h7-10,16,20,23,28H,2-6,11-15,17H2,1H3,(H,26,30)/t20-,23+/m1/s1 |
| InChIKey | NZPGQCKJWRXJBP-OFNKIYASSA-N |
| XLogP | 2.10 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|