C23H37NO8S — CID 6668643
(2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6668643) has the molecular formula C23H37NO8S and a molecular weight of 487.62 g/mol. Its IUPAC name is (2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6668643 |
| Molecular Formula | C23H37NO8S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | (2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)N(C)CC(OC)OC)=C[C@@H](c2ccsc2)[C@H]1CCOCCOCCO |
| InChI | InChI=1S/C23H37NO8S/c1-5-31-23-18(6-9-29-11-12-30-10-8-25)19(17-7-13-33-16-17)14-20(32-23)22(26)24(2)15-21(27-3)28-4/h7,13-14,16,18-19,21,23,25H,5-6,8-12,15H2,1-4H3/t18-,19+,23+/m1/s1 |
| InChIKey | CYZKNFJAJROLTL-MSYCTHLASA-N |
| XLogP | 2.22 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|