C21H30O7S — CID 6671938
prop-2-enyl (2R,3S,4S)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 6671938) has the molecular formula C21H30O7S and a molecular weight of 426.53 g/mol. Its IUPAC name is prop-2-enyl (2R,3S,4S)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | prop-2-enyl (2R,3S,4S)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 6671938 |
| Molecular Formula | C21H30O7S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | prop-2-enyl (2R,3S,4S)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C[C@H](c2ccsc2)[C@H](CCOCCOCCO)[C@H](OCC)O1 |
| InChI | InChI=1S/C21H30O7S/c1-3-8-27-20(23)19-14-18(16-6-13-29-15-16)17(21(28-19)26-4-2)5-9-24-11-12-25-10-7-22/h3,6,13-15,17-18,21-22H,1,4-5,7-12H2,2H3/t17-,18+,21+/m0/s1 |
| InChIKey | INEFZOHJCNPJGI-WAOWUJCRSA-N |
| XLogP | 2.87 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|