C21H26N2O4S — CID 3615375
N-(2-aminophenyl)-2-ethoxy-3-(3-hydroxypropyl)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 3615375) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-ethoxy-3-(3-hydroxypropyl)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | N-(2-aminophenyl)-2-ethoxy-3-(3-hydroxypropyl)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 3615375 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-(2-aminophenyl)-2-ethoxy-3-(3-hydroxypropyl)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCOC1OC(C(=O)Nc2ccccc2N)=CC(c2ccsc2)C1CCCO |
| InChI | InChI=1S/C21H26N2O4S/c1-2-26-21-15(6-5-10-24)16(14-9-11-28-13-14)12-19(27-21)20(25)23-18-8-4-3-7-17(18)22/h3-4,7-9,11-13,15-16,21,24H,2,5-6,10,22H2,1H3,(H,23,25) |
| InChIKey | QXEMHLRAXHUOHT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|