C20H26O5 — CID 69247690
prop-2-enyl (2R,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 69247690) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is prop-2-enyl (2R,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | prop-2-enyl (2R,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 69247690 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | prop-2-enyl (2R,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C[C@@H](c2ccccc2)[C@@H](CCCO)[C@H](OCC)O1 |
| InChI | InChI=1S/C20H26O5/c1-3-13-24-19(22)18-14-17(15-9-6-5-7-10-15)16(11-8-12-21)20(25-18)23-4-2/h3,5-7,9-10,14,16-17,20-21H,1,4,8,11-13H2,2H3/t16-,17+,20-/m1/s1 |
| InChIKey | QGKZZOHFEXCGJM-FUHIMQAGSA-N |
| XLogP | 3.16 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|