C22H26O6 — CID 6671804
prop-2-enyl (2R,3S,4S)-4-(1-benzofuran-3-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 6671804) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is prop-2-enyl (2R,3S,4S)-4-(1-benzofuran-3-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | prop-2-enyl (2R,3S,4S)-4-(1-benzofuran-3-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 6671804 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | prop-2-enyl (2R,3S,4S)-4-(1-benzofuran-3-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C[C@H](c2coc3ccccc23)[C@H](CCCO)[C@H](OCC)O1 |
| InChI | InChI=1S/C22H26O6/c1-3-12-26-21(24)20-13-17(16(9-7-11-23)22(28-20)25-4-2)18-14-27-19-10-6-5-8-15(18)19/h3,5-6,8,10,13-14,16-17,22-23H,1,4,7,9,11-12H2,2H3/t16-,17-,22+/m0/s1 |
| InChIKey | MLDGKHUWDXMSIG-PNLZDCPESA-N |
| XLogP | 3.91 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|