C27H34N2O5S — CID 59148250
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(2S,4S)-2-pentoxy-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-yl]methanone (PubChem CID 59148250) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(2S,4S)-2-pentoxy-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-yl]methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(2S,4S)-2-pentoxy-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-yl]methanone |
|---|---|
| PubChem CID | 59148250 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(2S,4S)-2-pentoxy-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-yl]methanone |
| SMILES | CCCCCO[C@@H]1C[C@H](c2cccs2)C=C(C(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)O1 |
| InChI | InChI=1S/C27H34N2O5S/c1-2-3-4-13-31-26-17-21(25-6-5-14-35-25)16-24(34-26)27(30)29-11-9-28(10-12-29)18-20-7-8-22-23(15-20)33-19-32-22/h5-8,14-16,21,26H,2-4,9-13,17-19H2,1H3/t21-,26+/m1/s1 |
| InChIKey | OHBUUGATXVCHKI-RLWLMLJZSA-N |
| XLogP | 4.74 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|