C38H47N3O7 — CID 6668892
(2R,3R,4S)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-4-(9H-fluoren-1-yl)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6668892) has the molecular formula C38H47N3O7 and a molecular weight of 657.81 g/mol. Its IUPAC name is (2R,3R,4S)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-4-(9H-fluoren-1-yl)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-4-(9H-fluoren-1-yl)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6668892 |
| Molecular Formula | C38H47N3O7 |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.34 |
| IUPAC Name | (2R,3R,4S)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-4-(9H-fluoren-1-yl)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)NCCCCC(=O)Nc2ccccc2N)=C[C@H](c2cccc3c2Cc2ccccc2-3)[C@H]1CCOCCOCCO |
| InChI | InChI=1S/C38H47N3O7/c1-2-47-38-30(17-20-45-22-23-46-21-19-42)32(29-13-9-12-28-27-11-4-3-10-26(27)24-31(28)29)25-35(48-38)37(44)40-18-8-7-16-36(43)41-34-15-6-5-14-33(34)39/h3-6,9-15,25,30,32,38,42H,2,7-8,16-24,39H2,1H3,(H,40,44)(H,41,43)/t30-,32-,38-/m1/s1 |
| InChIKey | FVCLHJJFJZCVIS-OJYMKHDISA-N |
| XLogP | 5.16 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|