C38H36N2O4S — CID 6670778
(2S,3R,4R)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6670778) has the molecular formula C38H36N2O4S and a molecular weight of 616.78 g/mol. Its IUPAC name is (2S,3R,4R)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6670778 |
| Molecular Formula | C38H36N2O4S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | (2S,3R,4R)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)=C[C@@H](c2cccc3c2Cc2ccccc2-3)[C@H]1CCCO |
| InChI | InChI=1S/C38H36N2O4S/c1-3-43-38-30(12-7-19-41)32(29-11-6-10-28-27-9-5-4-8-25(27)21-31(28)29)22-34(44-38)36(42)39-26-16-14-24(15-17-26)37-40-33-18-13-23(2)20-35(33)45-37/h4-6,8-11,13-18,20,22,30,32,38,41H,3,7,12,19,21H2,1-2H3,(H,39,42)/t30-,32+,38+/m1/s1 |
| InChIKey | AZFTXUADMAYRKE-DVPGGLSDSA-N |
| XLogP | 8.23 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |