C31H32N2O4S — CID 6671068
(2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6671068) has the molecular formula C31H32N2O4S and a molecular weight of 528.67 g/mol. Its IUPAC name is (2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6671068 |
| Molecular Formula | C31H32N2O4S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)=C[C@H](c2ccccc2)[C@H]1CCCO |
| InChI | InChI=1S/C31H32N2O4S/c1-3-36-31-24(10-7-17-34)25(21-8-5-4-6-9-21)19-27(37-31)29(35)32-23-14-12-22(13-15-23)30-33-26-16-11-20(2)18-28(26)38-30/h4-6,8-9,11-16,18-19,24-25,31,34H,3,7,10,17H2,1-2H3,(H,32,35)/t24-,25-,31-/m1/s1 |
| InChIKey | GTDOUPWGYGNZMY-XQOXSZQVSA-N |
| XLogP | 6.66 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |