C32H32N2O6S — CID 6671762
(2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6671762) has the molecular formula C32H32N2O6S and a molecular weight of 572.68 g/mol. Its IUPAC name is (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6671762 |
| Molecular Formula | C32H32N2O6S |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)=C[C@H](c2ccc3c(c2)OCO3)[C@@H]1CCCO |
| InChI | InChI=1S/C32H32N2O6S/c1-3-37-32-23(5-4-14-35)24(21-9-13-26-27(16-21)39-18-38-26)17-28(40-32)30(36)33-22-10-7-20(8-11-22)31-34-25-12-6-19(2)15-29(25)41-31/h6-13,15-17,23-24,32,35H,3-5,14,18H2,1-2H3,(H,33,36)/t23-,24+,32+/m0/s1 |
| InChIKey | OQHQKAYHNRTZOX-JOUUIMRQSA-N |
| XLogP | 6.39 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |