C23H25BrN2O4 — CID 23876782
[2-(4-bromo-2-ethyl-6-methylanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 23876782) has the molecular formula C23H25BrN2O4 and a molecular weight of 473.37 g/mol. Its IUPAC name is [2-(4-bromo-2-ethyl-6-methylanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-bromo-2-ethyl-6-methylanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 23876782 |
| Molecular Formula | C23H25BrN2O4 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | [2-(4-bromo-2-ethyl-6-methylanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCc1cc(Br)cc(C)c1NC(=O)COC(=O)C1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H25BrN2O4/c1-3-17-10-19(24)9-15(2)22(17)25-20(27)14-30-23(29)18-11-21(28)26(13-18)12-16-7-5-4-6-8-16/h4-10,18H,3,11-14H2,1-2H3,(H,25,27) |
| InChIKey | SPXKFLANDUPIHJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |