C22H22N2O6 — CID 5223111
[2-(2-methoxycarbonylanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 5223111) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is [2-(2-methoxycarbonylanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 5223111 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)C1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H22N2O6/c1-29-22(28)17-9-5-6-10-18(17)23-19(25)14-30-21(27)16-11-20(26)24(13-16)12-15-7-3-2-4-8-15/h2-10,16H,11-14H2,1H3,(H,23,25) |
| InChIKey | IGOJPNAVBHOSAI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |