C20H19IN2O4 — CID 2397418
[2-(4-iodoanilino)-2-oxoethyl] (3R)-1-benzyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 2397418) has the molecular formula C20H19IN2O4 and a molecular weight of 478.29 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] (3R)-1-benzyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] (3R)-1-benzyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 2397418 |
| Molecular Formula | C20H19IN2O4 |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] (3R)-1-benzyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC(=O)N(Cc2ccccc2)C1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C20H19IN2O4/c21-16-6-8-17(9-7-16)22-18(24)13-27-20(26)15-10-19(25)23(12-15)11-14-4-2-1-3-5-14/h1-9,15H,10-13H2,(H,22,24)/t15-/m1/s1 |
| InChIKey | PRYLFLZUMVCYLA-OAHLLOKOSA-N |
| XLogP | 2.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|