C20H18ClFN2O4 — CID 5191970
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 5191970) has the molecular formula C20H18ClFN2O4 and a molecular weight of 404.83 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 5191970 |
| Molecular Formula | C20H18ClFN2O4 |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)C1CC(=O)N(Cc2ccccc2)C1)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C20H18ClFN2O4/c21-15-6-7-17(16(22)9-15)23-18(25)12-28-20(27)14-8-19(26)24(11-14)10-13-4-2-1-3-5-13/h1-7,9,14H,8,10-12H2,(H,23,25) |
| InChIKey | RVBWWQGFUCGILO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |