C22H26BrN5O4 — CID 23880500
4-[[2-(5-bromo-3-pyridinyl)acetyl]amino]-N-methyl-N-[2-(4-nitrophenyl)ethyl]piperidine-4-carboxamide (PubChem CID 23880500) has the molecular formula C22H26BrN5O4 and a molecular weight of 504.39 g/mol. Its IUPAC name is 4-[[2-(5-bromo-3-pyridinyl)acetyl]amino]-N-methyl-N-[2-(4-nitrophenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 4-[[2-(5-bromo-3-pyridinyl)acetyl]amino]-N-methyl-N-[2-(4-nitrophenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 23880500 |
| Molecular Formula | C22H26BrN5O4 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 4-[[2-(5-bromo-3-pyridinyl)acetyl]amino]-N-methyl-N-[2-(4-nitrophenyl)ethyl]piperidine-4-carboxamide |
| SMILES | CN(CCc1ccc([N+](=O)[O-])cc1)C(=O)C1(NC(=O)Cc2cncc(Br)c2)CCNCC1 |
| InChI | InChI=1S/C22H26BrN5O4/c1-27(11-6-16-2-4-19(5-3-16)28(31)32)21(30)22(7-9-24-10-8-22)26-20(29)13-17-12-18(23)15-25-14-17/h2-5,12,14-15,24H,6-11,13H2,1H3,(H,26,29) |
| InChIKey | ITAVUGMROWBJSX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|