C23H24N2O3S — CID 23881471
1-(4-methoxyphenyl)-3-(4-methylphenyl)sulfanyl-4-piperidin-1-ylpyrrole-2,5-dione (PubChem CID 23881471) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(4-methylphenyl)sulfanyl-4-piperidin-1-ylpyrrole-2,5-dione.
| Compound Name | 1-(4-methoxyphenyl)-3-(4-methylphenyl)sulfanyl-4-piperidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 23881471 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(4-methylphenyl)sulfanyl-4-piperidin-1-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(Sc3ccc(C)cc3)=C(N3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O3S/c1-16-6-12-19(13-7-16)29-21-20(24-14-4-3-5-15-24)22(26)25(23(21)27)17-8-10-18(28-2)11-9-17/h6-13H,3-5,14-15H2,1-2H3 |
| InChIKey | OHTUIEMHNSBVSS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|