C22H17F2N3O2 — CID 23883158
N-[2,2-bis(4-fluorophenyl)-2-hydroxyethyl]-1H-benzimidazole-2-carboxamide (PubChem CID 23883158) has the molecular formula C22H17F2N3O2 and a molecular weight of 393.39 g/mol. Its IUPAC name is N-[2,2-bis(4-fluorophenyl)-2-hydroxyethyl]-1H-benzimidazole-2-carboxamide.
| Compound Name | N-[2,2-bis(4-fluorophenyl)-2-hydroxyethyl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 23883158 |
| Molecular Formula | C22H17F2N3O2 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[2,2-bis(4-fluorophenyl)-2-hydroxyethyl]-1H-benzimidazole-2-carboxamide |
| SMILES | O=C(NCC(O)(c1ccc(F)cc1)c1ccc(F)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H17F2N3O2/c23-16-9-5-14(6-10-16)22(29,15-7-11-17(24)12-8-15)13-25-21(28)20-26-18-3-1-2-4-19(18)27-20/h1-12,29H,13H2,(H,25,28)(H,26,27) |
| InChIKey | GVCMAZUZCLWYGS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |