C25H30N4O4 — CID 23884026
phenyl 2-[(4-aminocyclohexyl)carbamoyl]-3-(3-methylbenzoyl)imidazolidine-1-carboxylate (PubChem CID 23884026) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is phenyl 2-[(4-aminocyclohexyl)carbamoyl]-3-(3-methylbenzoyl)imidazolidine-1-carboxylate.
| Compound Name | phenyl 2-[(4-aminocyclohexyl)carbamoyl]-3-(3-methylbenzoyl)imidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 23884026 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | phenyl 2-[(4-aminocyclohexyl)carbamoyl]-3-(3-methylbenzoyl)imidazolidine-1-carboxylate |
| SMILES | Cc1cccc(C(=O)N2CCN(C(=O)Oc3ccccc3)C2C(=O)NC2CCC(N)CC2)c1 |
| InChI | InChI=1S/C25H30N4O4/c1-17-6-5-7-18(16-17)24(31)28-14-15-29(25(32)33-21-8-3-2-4-9-21)23(28)22(30)27-20-12-10-19(26)11-13-20/h2-9,16,19-20,23H,10-15,26H2,1H3,(H,27,30) |
| InChIKey | GVOHDWLIIMDPLN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |