C24H27FN4O3 — CID 23937280
N-(4-aminocyclohexyl)-1-benzoyl-3-(3-fluorobenzoyl)imidazolidine-2-carboxamide (PubChem CID 23937280) has the molecular formula C24H27FN4O3 and a molecular weight of 438.50 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-1-benzoyl-3-(3-fluorobenzoyl)imidazolidine-2-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-1-benzoyl-3-(3-fluorobenzoyl)imidazolidine-2-carboxamide |
|---|---|
| PubChem CID | 23937280 |
| Molecular Formula | C24H27FN4O3 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-(4-aminocyclohexyl)-1-benzoyl-3-(3-fluorobenzoyl)imidazolidine-2-carboxamide |
| SMILES | NC1CCC(NC(=O)C2N(C(=O)c3ccccc3)CCN2C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C24H27FN4O3/c25-18-8-4-7-17(15-18)24(32)29-14-13-28(23(31)16-5-2-1-3-6-16)22(29)21(30)27-20-11-9-19(26)10-12-20/h1-8,15,19-20,22H,9-14,26H2,(H,27,30) |
| InChIKey | AFTXJTOEAIUYCY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |