C17H23NOS — CID 23887511
2-cyclohexylsulfanyl-1-(2,3-dihydroindol-1-yl)propan-1-one (PubChem CID 23887511) has the molecular formula C17H23NOS and a molecular weight of 289.44 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-1-(2,3-dihydroindol-1-yl)propan-1-one.
| Compound Name | 2-cyclohexylsulfanyl-1-(2,3-dihydroindol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 23887511 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-cyclohexylsulfanyl-1-(2,3-dihydroindol-1-yl)propan-1-one |
| SMILES | CC(SC1CCCCC1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H23NOS/c1-13(20-15-8-3-2-4-9-15)17(19)18-12-11-14-7-5-6-10-16(14)18/h5-7,10,13,15H,2-4,8-9,11-12H2,1H3 |
| InChIKey | JUZCDPRHPKQKGD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |