C28H24N2O6 — CID 23888274
3-[2-(2-methyl-1-oxo-4-phenylisoquinoline-3-carbonyl)oxybutanoylamino]benzoic acid (PubChem CID 23888274) has the molecular formula C28H24N2O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is 3-[2-(2-methyl-1-oxo-4-phenylisoquinoline-3-carbonyl)oxybutanoylamino]benzoic acid.
| Compound Name | 3-[2-(2-methyl-1-oxo-4-phenylisoquinoline-3-carbonyl)oxybutanoylamino]benzoic acid |
|---|---|
| PubChem CID | 23888274 |
| Molecular Formula | C28H24N2O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 3-[2-(2-methyl-1-oxo-4-phenylisoquinoline-3-carbonyl)oxybutanoylamino]benzoic acid |
| SMILES | CCC(OC(=O)c1c(-c2ccccc2)c2ccccc2c(=O)n1C)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C28H24N2O6/c1-3-22(25(31)29-19-13-9-12-18(16-19)27(33)34)36-28(35)24-23(17-10-5-4-6-11-17)20-14-7-8-15-21(20)26(32)30(24)2/h4-16,22H,3H2,1-2H3,(H,29,31)(H,33,34) |
| InChIKey | JZRCMBGUVUDMOP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |