C17H14ClN3O4S3 — CID 2388846
4-chloro-N-[4-(2,2-dioxo-3,4-dihydro-[1,3]thiazolo[2,3-c][1,2,4]thiadiazin-6-yl)phenyl]benzenesulfonamide (PubChem CID 2388846) has the molecular formula C17H14ClN3O4S3 and a molecular weight of 455.97 g/mol. Its IUPAC name is 4-chloro-N-[4-(2,2-dioxo-3,4-dihydro-[1,3]thiazolo[2,3-c][1,2,4]thiadiazin-6-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-(2,2-dioxo-3,4-dihydro-[1,3]thiazolo[2,3-c][1,2,4]thiadiazin-6-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2388846 |
| Molecular Formula | C17H14ClN3O4S3 |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | 4-chloro-N-[4-(2,2-dioxo-3,4-dihydro-[1,3]thiazolo[2,3-c][1,2,4]thiadiazin-6-yl)phenyl]benzenesulfonamide |
| SMILES | O=S1(=O)CCN2C(c3ccc(NS(=O)(=O)c4ccc(Cl)cc4)cc3)=CSC2=N1 |
| InChI | InChI=1S/C17H14ClN3O4S3/c18-13-3-7-15(8-4-13)28(24,25)19-14-5-1-12(2-6-14)16-11-26-17-20-27(22,23)10-9-21(16)17/h1-8,11,19H,9-10H2 |
| InChIKey | LFGCASSQWYXSBL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |