C30H40ClN3O4S — CID 23897974
(5S,6S,7R)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,9-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897974) has the molecular formula C30H40ClN3O4S and a molecular weight of 574.19 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,9-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,9-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897974 |
| Molecular Formula | C30H40ClN3O4S |
| Molecular Weight | 574.19 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | (5S,6S,7R)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,9-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)CC(C)C)C(C(=O)N(CC=C)c3ccccc3Cl)C23S[C@@H]1CC3C |
| InChI | InChI=1S/C30H40ClN3O4S/c1-7-13-32(6)27(36)24-23-16-19(5)30(39-23)25(24)28(37)34(20(17-35)15-18(3)4)26(30)29(38)33(14-8-2)22-12-10-9-11-21(22)31/h7-12,18-20,23-26,35H,1-2,13-17H2,3-6H3/t19?,20-,23-,24+,25+,26?,30?/m1/s1 |
| InChIKey | JOEWFQCKDQHCAE-PNBQRIFKSA-N |
| XLogP | 4.25 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|