C25H30O5 — CID 23909393
9-(3,4-dimethoxyphenyl)-2,2,7,7-tetramethyl-3,6,8,9-tetrahydro-1H-xanthene-4,5-dione (PubChem CID 23909393) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenyl)-2,2,7,7-tetramethyl-3,6,8,9-tetrahydro-1H-xanthene-4,5-dione.
| Compound Name | 9-(3,4-dimethoxyphenyl)-2,2,7,7-tetramethyl-3,6,8,9-tetrahydro-1H-xanthene-4,5-dione |
|---|---|
| PubChem CID | 23909393 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 9-(3,4-dimethoxyphenyl)-2,2,7,7-tetramethyl-3,6,8,9-tetrahydro-1H-xanthene-4,5-dione |
| SMILES | COc1ccc(C2C3=C(OC4=C2CC(C)(C)CC4=O)C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C25H30O5/c1-24(2)10-15-21(14-7-8-19(28-5)20(9-14)29-6)16-11-25(3,4)13-18(27)23(16)30-22(15)17(26)12-24/h7-9,21H,10-13H2,1-6H3 |
| InChIKey | UCDMAAJLWPZQTA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |