C25H20ClNO3S — CID 23916760
ethyl 2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1-benzothiophene-3-carboxylate (PubChem CID 23916760) has the molecular formula C25H20ClNO3S and a molecular weight of 449.96 g/mol. Its IUPAC name is ethyl 2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23916760 |
| Molecular Formula | C25H20ClNO3S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | ethyl 2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N=Cc2cccc(OCc3ccc(Cl)cc3)c2)sc2ccccc12 |
| InChI | InChI=1S/C25H20ClNO3S/c1-2-29-25(28)23-21-8-3-4-9-22(21)31-24(23)27-15-18-6-5-7-20(14-18)30-16-17-10-12-19(26)13-11-17/h3-15H,2,16H2,1H3 |
| InChIKey | GJQWRUWKJJNYQV-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|