C28H32BNO7 — CID 23918622
[3-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-4-methyl-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid (PubChem CID 23918622) has the molecular formula C28H32BNO7 and a molecular weight of 505.38 g/mol. Its IUPAC name is [3-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-4-methyl-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid.
| Compound Name | [3-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-4-methyl-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23918622 |
| Molecular Formula | C28H32BNO7 |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | [3-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-4-methyl-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
| SMILES | CC/C(=C\c1ccc(CO)o1)CC[C@H]1OC[C@H]2C1=C(C)C[C@H]1C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C28H32BNO7/c1-3-17(12-20-8-9-21(14-31)37-20)7-10-24-25-16(2)11-22-26(23(25)15-36-24)28(33)30(27(22)32)19-6-4-5-18(13-19)29(34)35/h4-6,8-9,12-13,22-24,26,31,34-35H,3,7,10-11,14-15H2,1-2H3/b17-12+/t22-,23+,24-,26-/m1/s1 |
| InChIKey | ZBPIFXKABYVQHE-TWLVKPQVSA-N |
| XLogP | 2.57 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|