C33H39NO4 — CID 23918662
(3R,5aR,8aS,8bR)-3-[(3E)-3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentyl]-7-phenyl-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23918662) has the molecular formula C33H39NO4 and a molecular weight of 513.68 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(3E)-3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentyl]-7-phenyl-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(3E)-3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentyl]-7-phenyl-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23918662 |
| Molecular Formula | C33H39NO4 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(3E)-3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentyl]-7-phenyl-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3cc(C)c(O)c(C)c3)CC)OC[C@@H]2[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C33H39NO4/c1-5-10-24-18-26-30(33(37)34(32(26)36)25-11-8-7-9-12-25)27-19-38-28(29(24)27)14-13-22(6-2)17-23-15-20(3)31(35)21(4)16-23/h7-9,11-12,15-17,26-28,30,35H,5-6,10,13-14,18-19H2,1-4H3/b22-17+/t26-,27+,28-,30-/m1/s1 |
| InChIKey | NJVVWQDXKFUNQL-MJOLBHSFSA-N |
| XLogP | 6.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|