C31H36N6O4 — CID 23919368
(4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23919368) has the molecular formula C31H36N6O4 and a molecular weight of 556.67 g/mol. Its IUPAC name is (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23919368 |
| Molecular Formula | C31H36N6O4 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | C[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(Cc1ccccc1CN=[N+]=[N-])C(=O)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C31H36N6O4/c1-22-31(19-25-7-4-5-8-26(25)21-34-36-32,30(39)33-20-23-9-13-27(14-10-23)37(2)3)35-29(41-22)24-11-15-28(16-12-24)40-18-6-17-38/h4-5,7-16,22,38H,6,17-21H2,1-3H3,(H,33,39)/t22-,31-/m1/s1 |
| InChIKey | VQOKFVKWYWCYBH-JPZYQRIQSA-N |
| XLogP | 4.79 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|