C17H17NO3 — CID 23919667
(3S,4R,5S)-5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxylic acid (PubChem CID 23919667) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (3S,4R,5S)-5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxylic acid.
| Compound Name | (3S,4R,5S)-5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 23919667 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (3S,4R,5S)-5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxylic acid |
| SMILES | C[C@@H]1ON(c2ccccc2)[C@H](c2ccccc2)[C@H]1C(=O)O |
| InChI | InChI=1S/C17H17NO3/c1-12-15(17(19)20)16(13-8-4-2-5-9-13)18(21-12)14-10-6-3-7-11-14/h2-12,15-16H,1H3,(H,19,20)/t12-,15-,16+/m0/s1 |
| InChIKey | ZVISIOHMFLGRAA-VBNZEHGJSA-N |
| XLogP | 3.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |