C27H34N2O6S — CID 23923507
but-3-enyl (5S,6R,7S)-3-(3-hydroxypropyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23923507) has the molecular formula C27H34N2O6S and a molecular weight of 514.64 g/mol. Its IUPAC name is but-3-enyl (5S,6R,7S)-3-(3-hydroxypropyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6R,7S)-3-(3-hydroxypropyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23923507 |
| Molecular Formula | C27H34N2O6S |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | but-3-enyl (5S,6R,7S)-3-(3-hydroxypropyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)N(CC=C)c2ccc(OC)cc2)N(CCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C27H34N2O6S/c1-4-6-17-35-26(33)21-20-12-13-27(36-20)22(21)24(31)29(15-7-16-30)23(27)25(32)28(14-5-2)18-8-10-19(34-3)11-9-18/h4-5,8-11,20-23,30H,1-2,6-7,12-17H2,3H3/t20-,21+,22-,23?,27?/m0/s1 |
| InChIKey | PJXXIPITRQWZOQ-NJKQDDEASA-N |
| XLogP | 2.81 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|