C34H41N3O6S — CID 23869255
(5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869255) has the molecular formula C34H41N3O6S and a molecular weight of 619.78 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869255 |
| Molecular Formula | C34H41N3O6S |
| Molecular Weight | 619.78 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N(CCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccc(OCC)cc3)[C@@H]3CCC12S3)c1ccc(OC)cc1 |
| InChI | InChI=1S/C34H41N3O6S/c1-5-19-35(23-11-15-26(16-12-23)43-7-3)31(39)28-27-17-18-34(44-27)29(28)32(40)37(21-8-22-38)30(34)33(41)36(20-6-2)24-9-13-25(42-4)14-10-24/h5-6,9-16,27-30,38H,1-2,7-8,17-22H2,3-4H3/t27-,28+,29-,30?,34?/m0/s1 |
| InChIKey | ZGQCJXKUOZUPOS-JFSIGVLCSA-N |
| XLogP | 4.31 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|