C30H40BrN3O6 — CID 23926071
(5R,6R,7S)-8-bromo-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23926071) has the molecular formula C30H40BrN3O6 and a molecular weight of 618.57 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23926071 |
| Molecular Formula | C30H40BrN3O6 |
| Molecular Weight | 618.57 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCCC)C(=O)C1N(CCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)c3ccc(OCC)cc3)[C@@H]3OC12CC3Br |
| InChI | InChI=1S/C30H40BrN3O6/c1-5-9-16-32(14-6-2)29(38)26-30-19-22(31)25(40-30)23(24(30)28(37)34(26)17-18-35)27(36)33(15-7-3)20-10-12-21(13-11-20)39-8-4/h6-7,10-13,22-26,35H,2-3,5,8-9,14-19H2,1,4H3/t22?,23-,24+,25-,26?,30?/m1/s1 |
| InChIKey | LAJZEJKNTUORIW-KKDZCOMBSA-N |
| XLogP | 3.16 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|