C14H8BrN3O4S — CID 23932295
[2-bromo-5-[(3,7-dioxo-[1,3]thiazolo[3,2-b][1,2,4]triazin-2-ylidene)methyl]phenyl] acetate (PubChem CID 23932295) has the molecular formula C14H8BrN3O4S and a molecular weight of 394.21 g/mol. Its IUPAC name is [2-bromo-5-[(3,7-dioxo-[1,3]thiazolo[3,2-b][1,2,4]triazin-2-ylidene)methyl]phenyl] acetate.
| Compound Name | [2-bromo-5-[(3,7-dioxo-[1,3]thiazolo[3,2-b][1,2,4]triazin-2-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 23932295 |
| Molecular Formula | C14H8BrN3O4S |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 392.94 |
| IUPAC Name | [2-bromo-5-[(3,7-dioxo-[1,3]thiazolo[3,2-b][1,2,4]triazin-2-ylidene)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(C=c2sc3nc(=O)cnn3c2=O)ccc1Br |
| InChI | InChI=1S/C14H8BrN3O4S/c1-7(19)22-10-4-8(2-3-9(10)15)5-11-13(21)18-14(23-11)17-12(20)6-16-18/h2-6H,1H3 |
| InChIKey | ORLSPPZJZTYNQT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|