C18H12BrN3O4S — CID 2257455
[4-[(Z)-(10-bromo-3-oxo-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-4-ylidene)methyl]-2-methoxyphenyl] acetate (PubChem CID 2257455) has the molecular formula C18H12BrN3O4S and a molecular weight of 446.28 g/mol. Its IUPAC name is [4-[(Z)-(10-bromo-3-oxo-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-4-ylidene)methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-(10-bromo-3-oxo-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-4-ylidene)methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 2257455 |
| Molecular Formula | C18H12BrN3O4S |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | [4-[(Z)-(10-bromo-3-oxo-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-4-ylidene)methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=c2\sc3nc4cc(Br)cnc4n3c2=O)ccc1OC(C)=O |
| InChI | InChI=1S/C18H12BrN3O4S/c1-9(23)26-13-4-3-10(5-14(13)25-2)6-15-17(24)22-16-12(21-18(22)27-15)7-11(19)8-20-16/h3-8H,1-2H3/b15-6- |
| InChIKey | IPUXBPKMNJWTQR-UUASQNMZSA-N |
| XLogP | 2.55 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|